For research use only. Not for therapeutic Use.
MUN91789（Cat No.:I032886）is a synthetic chemical compound with significant research potential in the field of cancer therapy. It is primarily studied for its inhibitory effects on specific protein kinases and cell signaling pathways that are implicated in cancer cell proliferation and survival. As a potent molecular inhibitor, MUN91789 shows promise in targeting tumor growth and metastasis, making it a valuable candidate for developing novel cancer treatments. Ongoing studies focus on its efficacy, safety profile, and potential applications in personalized oncology therapies.
| Catalog Number | I032886 |
| CAS Number | 2144491-78-9 |
| Synonyms | CPD77; CPD-77; CPD 77; MUN91789; MUN-91789; MUN 91789; |
| Molecular Formula | C27H33N5O2 |
| Purity | 98% |
| Target | SARS-CoV |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N-(4-tert-butylphenyl)-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-1H-imidazole-5-carboxamide |
| InChI | InChI=1S/C27H33N5O2/c1-27(2,3)20-11-13-22(14-12-20)32(26(34)23-17-29-18-30-23)24(19-8-7-15-28-16-19)25(33)31-21-9-5-4-6-10-21/h7-8,11-18,21,24H,4-6,9-10H2,1-3H3,(H,29,30)(H,31,33) |
| InChIKey | MUNFBYOTGGMQOS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N(C(C2=CN=CC=C2)C(=O)NC3CCCCC3)C(=O)C4=CN=CN4 |
| Reference | Andrianov, Alexander M.; Kornoushenko, Yuri V.; Karpenko, Anna D.; Bosko, Ivan P.; Tuzikov, Alexander V. Computational discovery of small drug-like compounds as potential inhibitors of SARS-CoV-2 main protease. ChemRxiv. 2020, Pages1-21. |
