For research use only. Not for therapeutic Use.
Muscimol(CAT: R000977) is a potent psychoactive compound found in the Amanita muscaria mushroom, also known as the fly agaric. Its mode of action involves acting as a GABA receptor agonist in the central nervous system, leading to inhibitory effects on neuronal activity. Pharmacologically, muscimol is a hallucinogenic substance and accounts for the psychoactive properties of Amanita muscaria consumption. The compound can induce altered states of consciousness, hallucinations, and other psychoactive effects.
| Catalog Number | R000977 |
| CAS Number | 2763-96-4 |
| Synonyms | 5-Aminomethyl-3-hydroxyisoxazole; 5-(Aminomethyl)-3(2H)-isoxazolone; ?Agarin; Agarine; NSC 333569; Pantherine; |
| Molecular Formula | C4H6N2O2 |
| Purity | ≥95% |
| Target | GABA Receptor |
| Solubility | Soluble to 100 mM in sterile water |
| Storage | Store at RT |
| IUPAC Name | 5-(aminomethyl)-1,2-oxazol-3-one |
| InChI | InChI=1S/C4H6N2O2/c5-2-3-1-4(7)6-8-3/h1H,2,5H2,(H,6,7) |
| InChIKey | ZJQHPWUVQPJPQT-UHFFFAOYSA-N |
| SMILES | C1=C(ONC1=O)CN |
