For research use only. Not for therapeutic Use.
Muscone (Cat.No:R060180) is the primary active monomer in traditional Chinese medicine musk, derived from the musk glands of certain mammals. Renowned for its distinctive musky fragrance used extensively in the perfume industry, muscone also exhibits significant biological activities. It inhibits NF-κB and NLRP3 inflammasome activation, markedly reducing inflammatory cytokines like IL-1β, TNF-α, and IL-6, thereby enhancing cardiac function and survival rates. Additionally, muscone possesses potential anti-inflammatory and neuroprotective effects, making it valuable in both olfactory research and therapeutic applications.
| Catalog Number | R060180 |
| CAS Number | 541-91-3 |
| Synonyms | (±)-Muscone; 3-Methylcyclopentadecanone; Moschus Ketone; Muskone; dl-Muscone |
| Molecular Formula | C16H30O |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 3-methylcyclopentadecan-1-one |
| InChI | InChI=1S/C16H30O/c1-15-12-10-8-6-4-2-3-5-7-9-11-13-16(17)14-15/h15H,2-14H2,1H3 |
| InChIKey | ALHUZKCOMYUFRB-UHFFFAOYSA-N |
| SMILES | CC1CCCCCCCCCCCCC(=O)C1 |
