For research use only. Not for therapeutic Use.
The mutagenic impurity of Tenofovir Disoproxil (Cat.No:I013752) refers to a specific substance present as an impurity in the pharmaceutical compound Tenofovir Disoproxil. This impurity possesses mutagenic properties, meaning it has the potential to induce genetic mutations in cells. Strict monitoring and control of such impurities are essential to ensure the safety and efficacy of pharmaceutical products.
| Catalog Number | I013752 |
| CAS Number | 1446486-33-4 |
| Molecular Formula | C₈H₉N₅ |
| Purity | ≥95% |
| Target | HIV |
| Solubility | DMSO: ≥ 29 mg/mL |
| IUPAC Name | 9-[(E)-prop-1-enyl]purin-6-amine |
| InChI | InChI=1S/C8H9N5/c1-2-3-13-5-12-6-7(9)10-4-11-8(6)13/h2-5H,1H3,(H2,9,10,11)/b3-2+ |
| InChIKey | ACWCANXGLNLMJB-NSCUHMNNSA-N |
| SMILES | CC=CN1C=NC2=C1N=CN=C2N |
