For research use only. Not for therapeutic Use.
Mutanocyclin（Cat No.:I041050）is an investigational antimicrobial compound known for its potent activity against resistant bacterial strains. Belonging to the class of cyclopeptides, it exhibits a unique mechanism of action by targeting bacterial cell membrane integrity, leading to rapid bacterial cell death. Its efficacy has been explored in treating infections caused by multi-drug resistant pathogens, including Gram-positive bacteria like methicillin-resistant Staphylococcus aureus (MRSA). Due to its promising therapeutic potential, Mutanocyclin is being studied in both preclinical and clinical settings for its application in combating antibiotic-resistant infections.
| CAS Number | 875455-92-8 |
| Synonyms | (2R)-4-acetyl-3-hydroxy-2-(2-methylpropyl)-1,2-dihydropyrrol-5-one |
| Molecular Formula | C10H15NO3 |
| Purity | ≥95% |
| IUPAC Name | (2R)-4-acetyl-3-hydroxy-2-(2-methylpropyl)-1,2-dihydropyrrol-5-one |
| InChI | InChI=1S/C10H15NO3/c1-5(2)4-7-9(13)8(6(3)12)10(14)11-7/h5,7,13H,4H2,1-3H3,(H,11,14)/t7-/m1/s1 |
| InChIKey | SHHAXAUQMPMPRV-SSDOTTSWSA-N |
| SMILES | CC(C)C[C@@H]1C(=C(C(=O)N1)C(=O)C)O |
