For research use only. Not for therapeutic Use.
MY-943(Cat No.:I041228)is a small molecule compound developed for its potential therapeutic effects in the treatment of autoimmune diseases and cancer. It functions by selectively targeting and inhibiting specific molecular pathways involved in immune cell activation and tumor progression. MY-943 modulates immune responses and may reduce inflammation or enhance the anti-tumor immune response. Researchers are investigating its role in clinical applications, such as controlling abnormal immune reactions or inhibiting cancer cell growth. MY-943 represents a promising candidate for therapeutic intervention in diseases driven by immune dysregulation.
Synonyms | [2-[N-[(3-hydroxy-4-methoxyphenyl)methyl]-3,4,5-trimethoxyanilino]-2-oxoethyl] 4-(4-aminophenyl)piperazine-1-carbodithioate |
Molecular Formula | C30H36N4O6S2 |
Purity | ≥95% |
IUPAC Name | [2-[N-[(3-hydroxy-4-methoxyphenyl)methyl]-3,4,5-trimethoxyanilino]-2-oxoethyl] 4-(4-aminophenyl)piperazine-1-carbodithioate |
InChI | InChI=1S/C30H36N4O6S2/c1-37-25-10-5-20(15-24(25)35)18-34(23-16-26(38-2)29(40-4)27(17-23)39-3)28(36)19-42-30(41)33-13-11-32(12-14-33)22-8-6-21(31)7-9-22/h5-10,15-17,35H,11-14,18-19,31H2,1-4H3 |
InChIKey | IQDDCWYNBRRRQG-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)CN(C2=CC(=C(C(=C2)OC)OC)OC)C(=O)CSC(=S)N3CCN(CC3)C4=CC=C(C=C4)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |