For research use only. Not for therapeutic Use.
Mycophenolate sodium(CAT: M014857) is an immunosuppressive medication used in transplant medicine and autoimmune diseases. Its mode of action involves inhibiting the proliferation of certain immune cells, such as T and B lymphocytes, by blocking an enzyme called inosine monophosphate dehydrogenase (IMPDH). By doing so, mycophenolate sodium suppresses the immune response, which is beneficial in preventing rejection of transplanted organs and treating autoimmune conditions like lupus and rheumatoid arthritis.
CAS Number | 37415-62-6 |
Synonyms | mycophenolicacidmonosodiumsalt;mycophenolicmonosodiumsalt;sodiummycophenolate;MYCOPHENOLATE SODIUM;4-Hexenoic acid,6-(1,3-dihydro-4-hydroxy-6-Methoxy-7-Methyl-3-oxo-5-isobenzofuranyl)-4-Methyl-,sodiuM salt;4-Hexenoic acid,6-(1,3-dihydro-4-hydroxy-6-M |
Molecular Formula | C17H19NaO6 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | sodium;(E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
InChI | InChI=1S/C17H20O6.Na/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3;/h4,20H,5-8H2,1-3H3,(H,18,19);/q;+1/p-1/b9-4+; |
InChIKey | DOZYTHNHLLSNIK-JOKMOOFLSA-M |
SMILES | CC1=C(C(=C(C2=C1COC2=O)O)CC=C(C)CCC(=O)[O-])OC.[Na+] |
Reference | 1: Deuter CME, Engelmann K, Heiligenhaus A, Lanzl I, Mackensen F, Ness T, Pleyer <br> 3: Ordi-Ros J, Sáez-Comet L, Pérez-Conesa M, Vidal X, Mitjavila F, Castro Salomó 4: Genvigir FDV, Nishikawa AM, Felipe CR, Tedesco-Silva H Jr, Oliveira N, Salazar <br> 6: van Doesum WB, Gard L, Bemelman FJ, de Fijter JW, Homan van der Heide JJ, |