For research use only. Not for therapeutic Use.
Mycophenolic acid (Cat No.: A000307) is an immunosuppressive drug used to prevent organ rejection after transplants, such as kidney, heart, or liver transplants. It works by inhibiting inosine monophosphate dehydrogenase, an enzyme critical for the production of purines, which are necessary for the proliferation of T and B cells in the immune system. This suppresses the body’s immune response, reducing the likelihood of transplant rejection. Common side effects include gastrointestinal issues, infections, and bone marrow suppression. Regular monitoring is required during treatment.
| Catalog Number | A000307 |
| CAS Number | 24280-93-1 |
| Synonyms | 24280-93-1; Mycophenolate; Melbex; Myfortic; Mycophenolsaeure |
| Molecular Formula | C17H20O6 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
| InChI | 1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19)/b9-4+ |
| InChIKey | HPNSFSBZBAHARI-RUDMXATFSA-N |
| SMILES | CC1=C(C(=C(C2=C1COC2=O)O)CC=C(C)CCC(=O)O)OC |
