For research use only. Not for therapeutic Use.
Mycro 3（Cat No.:I012380） is a powerful and specific inhibitor of Myc-Max dimerization. This compound has demonstrated the ability to disrupt the formation of Myc-Max complexes, which play a crucial role in promoting oncogenic transcriptional activity. Mycro 3 shows potential for application in pancreatic cancer research, as Myc-Max complexes are frequently dysregulated in this cancer type. By targeting the Myc-Max interaction, Mycro 3 offers a promising avenue for studying the underlying mechanisms of pancreatic cancer and exploring potential therapeutic strategies against this disease.
| Catalog Number | I012380 |
| CAS Number | 944547-46-0 |
| Synonyms | 5-[[[7-(Chlorodifluoromethyl)-5-(2-furanyl)pyrazolo[1,5-a]pyrimidin-2-yl]carbonyl]amino]-1-phenyl-1H-pyrazole-4-carboxylic acid ethyl ester |
| Molecular Formula | C24H17ClF2N6O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl 5-[[7-[chloro(difluoro)methyl]-5-(furan-2-yl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-1-phenylpyrazole-4-carboxylate |
| InChI | InChI=1S/C24H17ClF2N6O4/c1-2-36-23(35)15-13-28-32(14-7-4-3-5-8-14)21(15)30-22(34)17-12-20-29-16(18-9-6-10-37-18)11-19(24(25,26)27)33(20)31-17/h3-13H,2H2,1H3,(H,30,34) |
| InChIKey | YPPNLSKYXDXQGD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC=CC=C2)NC(=O)C3=NN4C(=CC(=NC4=C3)C5=CC=CO5)C(F)(F)Cl |
