For research use only. Not for therapeutic Use.
Myricetin 3-β-Glucoside(Cat No.:R033670)is a flavonoid glycoside commonly found in various fruits, vegetables, and plants. This compound features myricetin, a potent antioxidant, linked to a glucose molecule via a β-glycosidic bond. Known for its anti-inflammatory, anti-cancer, and neuroprotective properties, Myricetin 3-β-Glucoside plays a significant role in modulating cellular signaling pathways, including those involved in oxidative stress and inflammation. It is widely studied for its potential health benefits, particularly in reducing the risk of chronic diseases such as cardiovascular conditions and cancer.
CAS Number | 19833-12-6 |
Synonyms | Isomyricitrin; Myricetin 3-Glucoside; Isomericitrin; Myricetin 3-β-D-Glucopyranoside; 3-(β-D-Glucopyranosyloxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one; 3,3’,4’,5,5’,7-Hexahydroxyflavone 3-β-D-Glucopyranoside; Myricetin 3-O-D-G |
Molecular Formula | C21H20O13 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
InChI | InChI=1S/C21H20O13/c22-5-12-15(28)17(30)18(31)21(33-12)34-20-16(29)13-8(24)3-7(23)4-11(13)32-19(20)6-1-9(25)14(27)10(26)2-6/h1-4,12,15,17-18,21-28,30-31H,5H2/t12-,15-,17+,18-,21+/m1/s1 |
InChIKey | FOHXFLPXBUAOJM-LIBJPBHASA-N |
SMILES | C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |