For research use only. Not for therapeutic Use.
Myricetin (Cat No.: R011671) is a naturally occurring flavonoid found in various fruits, vegetables, and herbs, such as berries, grapes, and tea. It is known for its antioxidant, anti-inflammatory, and anticancer properties. Myricetin has been shown to help neutralize free radicals, protect cells from oxidative damage, and reduce inflammation, which may contribute to its potential cardiovascular and neuroprotective benefits. Additionally, research suggests that myricetin may help inhibit the growth of cancer cells and support overall immune health. Further clinical studies are needed to confirm its therapeutic potential.
CAS Number | 529-44-2 |
Synonyms | 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one; 3,3’,4’,5,5’,7-Hexahydroxyflavone; 3,5,7,3’,4’,5’-Hexahydroxyflavone; Cannabiscetin; Myricetol; NSC 407290; |
Molecular Formula | C15H10O8 |
Purity | ≥95% |
Target | Autophagy |
Storage | -20℃ |
IUPAC Name | 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
InChI | 1S/C15H10O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,16-20,22H |
InChIKey | IKMDFBPHZNJCSN-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O |