Myristic acid-d5（Cat No.:S000769） is a deuterium-labeled version of myristic acid, a saturated fatty acid commonly found in coconut oil, palm kernel oil, and dairy products. Its chemical formula, C14H23D5O2, indicates that five hydrogen atoms have been replaced by deuterium. This isotopic enhancement significantly boosts its analytical detectability and stability, particularly in mass spectrometry and NMR spectroscopy. Myristic acid-d5 is essential for research focused on lipid metabolism and the biochemical pathways of fatty acids, providing clearer insights into the absorption, distribution, and transformation of fatty acids within various biological systems.
| Catalog Number | S000769 |
| CAS Number | 327077-03-2 |
| Molecular Formula | C14H23D5O2 |
| Purity | ≥95% |
| IUPAC Name | 13,13,14,14,14-pentadeuteriotetradecanoic acid |
| InChI | InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/i1D3,2D2 |
| InChIKey | TUNFSRHWOTWDNC-ZBJDZAJPSA-N |
| SMILES | CCCCCCCCCCCCCC(=O)O |
