For research use only. Not for therapeutic Use.
Myristoyl Chloride is a high-purity compound used in organic synthesis and industrial applications. This fatty acid chloride is essential for studying acylation reactions, producing surfactants, and synthesizing various esters and amides. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and material science applications. Ideal for experimental setups, Myristoyl Chloride enhances research accuracy and efficiency.
| Catalog Number | R022820 |
| CAS Number | 112-64-1 |
| Synonyms | Myristic Acid Chloride; NSC 9417; Tetradecanoic Acid Chloride; n-Tetradecanoyl Chloride; Tetradecanoyl Chloride |
| Molecular Formula | C14H27ClO |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | tetradecanoyl chloride |
| InChI | InChI=1S/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3 |
| InChIKey | LPWCRLGKYWVLHQ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCC(=O)Cl |
