For research use only. Not for therapeutic Use.
Myristyl-γ-picolinium Chloride is a quaternary ammonium compound widely used in cosmetic and personal care products for its surfactant and antimicrobial properties. Known for its effectiveness in conditioning and preserving formulations, it is essential in shampoos, conditioners, and skincare products. This compound’s high purity ensures consistent and reliable results in product performance. Its applications extend to household cleaning agents and industrial formulations, making it a valuable ingredient in advanced research and development across various industries.
| Catalog Number | R057189 |
| CAS Number | 2748-88-1 |
| Synonyms | 4-Methyl-1-tetradecylpyridinium Chloride; 1-Tetradecyl-4-picolinium Chloride; MPC; Miripirium Chloride; Quatresin; Wet-Tone B; |
| Molecular Formula | C20H36ClN |
| Purity | ≥95% |
| Storage | Store at +4 ℃ |
| IUPAC Name | 4-methyl-1-tetradecylpyridin-1-ium;chloride |
| InChI | InChI=1S/C20H36N.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-21-18-15-20(2)16-19-21;/h15-16,18-19H,3-14,17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZCTSINFCZHUVLI-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCCCCCC[N+]1=CC=C(C=C1)C.[Cl-] |
