For research use only. Not for therapeutic Use.
MZMNEDXVUJLQAF-JGVFFNPUSA-N(CAT: R073076) is a chemical compound with a specific stereochemical configuration of its constituent atoms. Its mode of action and pharmacological effects are not explicitly documented in the provided information. The compound’s structure suggests it could be a potential building block for organic synthesis or a precursor in the preparation of more complex molecules, particularly for pharmaceuticals or other specialized applications.
| Catalog Number | R073076 |
| CAS Number | 135042-17-0 |
| Molecular Formula | C11H19NO5 |
| Purity | ≥95% |
| Target | PROTAC |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChI | InChI=1S/C11H19NO5/c1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h7-8,13H,5-6H2,1-4H3/t7-,8+/m0/s1 |
| InChIKey | MZMNEDXVUJLQAF-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CC1C(=O)OC)O |
