For research use only. Not for therapeutic Use.
N-1-(1-Phenylcyclohexyl)-morpholine hydrochloride, also known as PCP or “angel dust,” is a dissociative anesthetic with hallucinogenic and neurotoxic effects. Initially developed for medical anesthesia, it is now predominantly encountered as a recreational drug. Its use is associated with severe psychological effects, including hallucinations and agitation, leading to significant health and safety concerns.
| Catalog Number | R035767 |
| CAS Number | 1934-49-2 |
| Synonyms | 4-(1-Phenylcyclohexyl)morpholine Hydrochloride; 1-(1-Phenylcyclohexyl)morpholine Hydrochloride |
| Molecular Formula | C16H24ClNO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-(1-phenylcyclohexyl)morpholine;hydrochloride |
| InChI | InChI=1S/C16H23NO.ClH/c1-3-7-15(8-4-1)16(9-5-2-6-10-16)17-11-13-18-14-12-17;/h1,3-4,7-8H,2,5-6,9-14H2;1H |
| InChIKey | RTARNXZLDAUNOX-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=CC=C2)N3CCOCC3.Cl |
