For research use only. Not for therapeutic Use.
N-(1-Methylethyl)-benzenemethanamine (Cat.No:M069823) is an organic compound with applications in the pharmaceutical and chemical industries. Also known as isopropylbenzylamine, it serves as a precursor in the synthesis of various pharmaceuticals and research chemicals. Its versatile structure makes it valuable for creating diverse molecules in chemical synthesis processes.
CAS Number | 102-97-6 |
Molecular Formula | C10H15N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-benzylpropan-2-amine |
InChI | InChI=1S/C10H15N/c1-9(2)11-8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3 |
InChIKey | LYBKPDDZTNUNNM-UHFFFAOYSA-N |
SMILES | CC(C)NCC1=CC=CC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |