For research use only. Not for therapeutic Use.
N-(1-Phenylethyl)formamide(CAT: L000344) is a compound with significance in the fields of organic chemistry and material science. This chemical, featuring a formamide group linked to a 1-phenylethyl moiety, serves as a versatile intermediate for various organic syntheses. In the realm of organic chemistry, it is often utilized in the preparation of structurally diverse compounds and as a key component in different chemical transformations.
CAS Number | 6948-01-2 |
Molecular Formula | C9H11NO |
Purity | ≥95% |
IUPAC Name | N-(1-phenylethyl)formamide |
InChI | InChI=1S/C9H11NO/c1-8(10-7-11)9-5-3-2-4-6-9/h2-8H,1H3,(H,10,11) |
InChIKey | CDHCCWRMWKZBGE-UHFFFAOYSA-N |