Home
>
Chemical Reagents>Organic Building Blocks> N-([1,1'-Biphenyl]-4-yl)-[1,1':2',1''-terphenyl]-4-amine
For research use only. Not for therapeutic Use.
N-([1,1′-Biphenyl]-4-yl)-[1,1′:2′,1”-terphenyl]-4-amine(CAT: L000406) is a notable compound primarily employed in the field of material chemistry. This molecule serves as a valuable building block for the synthesis of advanced organic materials. Its unique terphenyl and biphenyl motifs play a crucial role in enhancing the properties of materials, making it essential in the development of high-performance polymers and organic compounds.
Catalog Number | L000406 |
CAS Number | 1547491-61-1 |
Molecular Formula | C30H23N |
Purity | ≥95% |
IUPAC Name | 4-phenyl-N-[4-(2-phenylphenyl)phenyl]aniline |
InChI | InChI=1S/C30H23N/c1-3-9-23(10-4-1)24-15-19-27(20-16-24)31-28-21-17-26(18-22-28)30-14-8-7-13-29(30)25-11-5-2-6-12-25/h1-22,31H |
InChIKey | RGCJALITQCIYFF-UHFFFAOYSA-N |