Home
>
Chemical Reagents>Organic Building Blocks>
>
N-[(1R,2R)-2-aMino-1,2-bis(4-Methoxyphenyl)ethyl]-4-Methyl-BenzenesulfonaMide
For research use only. Not for therapeutic Use.
N-[(1R,2R)-2-amino-1,2-bis(4-methoxyphenyl)ethyl]-4-methyl-benzenesulfonamide (Cat.No:L003690) is a significant compound in pharmaceutical research. Its unique structure, containing a sulfonamide and amino group, lends itself to potential therapeutic applications. This compound is valuable in the development of novel drugs due to its distinctive pharmacophore. Its role in drug discovery exemplifies its importance in contemporary medicinal chemistry endeavors, highlighting its potential for innovative pharmaceutical agents.
Catalog Number | L003690 |
CAS Number | 852212-99-8 |
Molecular Formula | C23H26N2O4S |
Purity | ≥95% |
IUPAC Name | N-[(1R,2R)-2-amino-1,2-bis(4-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide |
InChI | InChI=1S/C23H26N2O4S/c1-16-4-14-21(15-5-16)30(26,27)25-23(18-8-12-20(29-3)13-9-18)22(24)17-6-10-19(28-2)11-7-17/h4-15,22-23,25H,24H2,1-3H3/t22-,23-/m1/s1 |
InChIKey | QECIBWAUSHWNEP-DHIUTWEWSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@H](C2=CC=C(C=C2)OC)[C@@H](C3=CC=C(C=C3)OC)N |