Home
>
Chemical Reagents>Organic Building Blocks> N-((1S,2S)-2-Amino-1,2-diphenylethyl)benzenesulfonamide
For research use only. Not for therapeutic Use.
N-((1S,2S)-2-Amino-1,2-diphenylethyl)benzenesulfonamide (Cat.No:L003817) is a crucial compound in medicinal chemistry. Its chiral, diphenylethylamine structure grants it significant pharmacological potential. This compound is employed as a key intermediate in the synthesis of pharmaceutical agents, particularly in the development of innovative drugs with enhanced therapeutic properties.
CAS Number | 300345-91-9 |
Molecular Formula | C20H20N2O2S |
Purity | ≥95% |
IUPAC Name | N-[(1S,2S)-2-amino-1,2-diphenylethyl]benzenesulfonamide |
InChI | InChI=1S/C20H20N2O2S/c21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)22-25(23,24)18-14-8-3-9-15-18/h1-15,19-20,22H,21H2/t19-,20-/m0/s1 |
InChIKey | UQFIIYNKTOHATG-PMACEKPBSA-N |
SMILES | C1=CC=C(C=C1)[C@@H]([C@H](C2=CC=CC=C2)NS(=O)(=O)C3=CC=CC=C3)N |