Home
>
Catalysts and Ligands>Chiral catalyst> N-((1S,2S)-2-Amino-1,2-diphenylethyl)methanesulfonamide
For research use only. Not for therapeutic Use.
N-((1S,2S)-2-Amino-1,2-diphenylethyl)methanesulfonamide (Cat.No:L003476) is a crucial compound in medicinal chemistry. Its chiral structure and sulfonamide functional group contribute to its significance as a potential pharmaceutical agent. This compound exhibits promising biological activity, making it a candidate for drug development, particularly in the realm of enzyme inhibitors.
CAS Number | 300345-76-0 |
Molecular Formula | C15H18N2O2S |
Purity | ≥95% |
IUPAC Name | N-[(1S,2S)-2-amino-1,2-diphenylethyl]methanesulfonamide |
InChI | InChI=1S/C15H18N2O2S/c1-20(18,19)17-15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12/h2-11,14-15,17H,16H2,1H3/t14-,15-/m0/s1 |
InChIKey | FSRRNSLQEDUDTP-GJZGRUSLSA-N |
SMILES | CS(=O)(=O)N[C@@H](C1=CC=CC=C1)[C@H](C2=CC=CC=C2)N |