For research use only. Not for therapeutic Use.
N-[2-(1H-imidazol-4-yl)ethyl]acrylamide (Cat No.:M122175) is a compound with potential biological and pharmaceutical applications. It contains an acrylamide group and an imidazole ring, which are both common in bioactive molecules. NImEA may exhibit biological activity due to its structural similarity to biologically active compounds and its potential to interact with biological macromolecules. This compound could be used as a building block in the synthesis of novel drugs or as a tool compound in biochemical research.
CAS Number | 10124-85-3 |
Synonyms | N-[2-(1H-Imidazol-4-yl)ethyl]acrylamide |
Molecular Formula | C8H11N3O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]prop-2-enamide |
InChI | InChI=1S/C8H11N3O/c1-2-8(12)10-4-3-7-5-9-6-11-7/h2,5-6H,1,3-4H2,(H,9,11)(H,10,12) |
InChIKey | PDNUJRVEYKRJFO-UHFFFAOYSA-N |
SMILES | C=CC(=O)NCCC1=CN=CN1 |