For research use only, not for therapeutic use.
N-2-(4-Bromobenzhydryloxy)ethyldimethylamine（Cat No.:M068119）is a synthetic organic compound that likely serves as a building block in pharmaceutical research or chemical synthesis. The benzhydryloxy group indicates potential for interactions with biological targets, possibly influencing receptor binding or enzyme inhibition. The presence of a bromine atom may enhance the compound’s binding affinity or selectivity in molecular interactions. While specific biological or therapeutic properties of this compound are not well-documented, it may be explored in research for drug development, chemical biology, or as a precursor in more complex syntheses.
| Catalog Number | M068119 |
| CAS Number | 118-23-0 |
| Molecular Formula | C17H20BrNO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[(4-bromophenyl)-phenylmethoxy]-N,N-dimethylethanamine |
| InChI | InChI=1S/C17H20BrNO/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15/h3-11,17H,12-13H2,1-2H3 |
| InChIKey | NUNIWXHYABYXKF-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C2=CC=C(C=C2)Br |
