Home
>
Inhibitors/Agonists>GPCR/G Protein> N-(2-((4-Chlorobenzyl)thio)benzo[d]thiazol-6-yl)-2-(morpholine-4-carbonyl)benzamide
For research use only. Not for therapeutic Use.
N-(2-((4-Chlorobenzyl)thio)benzo[d]thiazol-6-yl)-2-(morpholine-4-carbonyl)benzamide(Cat No.:L000433) is a chemically complex compound with potential applications in various scientific fields. Its structure encompasses multiple functional groups, including thio, benzothiazole, morpholine, and benzamide moieties, suggesting diverse interactions. This compound may engage with specific biological targets, making it intriguing in medicinal chemistry and drug development. Its mode of action could involve the modulation of cellular processes, potentially influencing disease-related pathways. Its distinct chemical attributes enable the design of novel compounds for applications in pharmaceuticals, materials science, and chemical research.
Catalog Number | L000433 |
CAS Number | 354126-20-8 |
Molecular Formula | C26H22ClN3O3S2 |
Purity | ≥95% |
Target | GPR35 |
IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-2-(morpholine-4-carbonyl)benzamide |
InChI | InChI=1S/C26H22ClN3O3S2/c27-18-7-5-17(6-8-18)16-34-26-29-22-10-9-19(15-23(22)35-26)28-24(31)20-3-1-2-4-21(20)25(32)30-11-13-33-14-12-30/h1-10,15H,11-14,16H2,(H,28,31) |
InChIKey | GMOURXCDGUPWHH-UHFFFAOYSA-N |
SMILES | C1COCCN1C(=O)C2=CC=CC=C2C(=O)NC3=CC4=C(C=C3)N=C(S4)SCC5=CC=C(C=C5)Cl |