For research use only. Not for therapeutic Use.
N-Acetyltyramine(Cat No.:R015804)is a quorum sensing inhibitor (QSI) compound naturally produced by Vibrio alginolyticus M3-10. It effectively inhibits the quorum sensing (QS) system of C. violaceum ATCC12472, a bacterium known for its QS-dependent violet pigmentation. N-Acetyltyramine also exhibits the ability to reverse drug resistance in doxorubicin-resistant leukemia P388 cells, indicating its potential as a chemosensitizer in cancer treatment. Its dual activities as a QSI and chemosensitizer make N-Acetyltyramine a promising compound for further research in the fields of antimicrobial agents and cancer therapeutics.
CAS Number | 1202-66-0 |
Synonyms | N-(p-Hydroxyphenethyl)acetamide; N-(4-Hydroxyphenethyl)acetamide; N-Acetyltyramine; N-[2-(4-Hydroxyphenyl)ethyl]acetamide; N-acetyltyramine; |
Molecular Formula | C10H13NO2 |
Purity | 95% |
Target | Bacterial |
Appearance | white solid |
Storage | -20°C |
Analysis method | HPLC |
IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]acetamide |
InChI | InChI=1S/C10H13NO2/c1-8(12)11-7-6-9-2-4-10(13)5-3-9/h2-5,13H,6-7H2,1H3,(H,11,12) |
InChIKey | ATDWJOOPFDQZNK-UHFFFAOYSA-N |
SMILES | CC(=O)NCCC1=CC=C(C=C1)O |