For research use only. Not for therapeutic Use.
N-(2-Aminoethyl)-N-methylethylenediamine(Cat No.:L006972), is a chemical compound often used as a chelating agent in coordination chemistry and metal-ion complexation studies. It is represented as C5H14N3 and features both aminoethyl and ethylenediamine functional groups, providing bi-dentate coordination. This compound has applications in various fields, including catalysis, analytical chemistry, and medicinal chemistry, where its chelating properties are harnessed to enhance the stability and reactivity of metal complexes. Its specific structure enables selective metal binding and plays a vital role in the development of catalysts, sensors, and pharmaceutical agents, contributing significantly to research and applications in these areas.
CAS Number | 4097-88-5 |
Molecular Formula | C5H15N3 |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | N'-(2-aminoethyl)-N'-methylethane-1,2-diamine |
InChI | InChI=1S/C5H15N3/c1-8(4-2-6)5-3-7/h2-7H2,1H3 |
InChIKey | HYSQEYLBJYFNMH-UHFFFAOYSA-N |
SMILES | CN(CCN)CCN |