For research use only. Not for therapeutic Use.
N-(2-Hydroxyethyl)-4-methyl-2-((4-methyl-1H-indol-3-yl)thio)pentamide(Cat No.:R028750)is a specialized compound used in advanced pharmaceutical research. Its unique structure, incorporating a hydroxyethyl group and a methylindole thioether, makes it valuable for studying biochemical pathways and drug interactions. This compound is essential for investigating enzyme activities and receptor binding assays. It provides precise analytical results due to its high purity and stability. Ideal for drug development and metabolic research, it supports cutting-edge scientific investigations, enhancing the understanding of complex biological systems.
CAS Number | 1027997-01-8 |
Synonyms | S 3969; |
Molecular Formula | C17H24N2O2S |
Purity | ≥95% |
Target | Sodium Channel |
Storage | -20°C |
IUPAC Name | N-(2-hydroxyethyl)-4-methyl-2-[(4-methyl-1H-indol-3-yl)sulfanyl]pentanamide |
InChI | InChI=1S/C17H24N2O2S/c1-11(2)9-14(17(21)18-7-8-20)22-15-10-19-13-6-4-5-12(3)16(13)15/h4-6,10-11,14,19-20H,7-9H2,1-3H3,(H,18,21) |
InChIKey | FTNIWEHRMFLJKE-UHFFFAOYSA-N |
SMILES | CC1=C2C(=CC=C1)NC=C2SC(CC(C)C)C(=O)NCCO |