For research use only. Not for therapeutic Use.
N-2-Hydroxyethyl Norephedrine Hydrochloride is a compound consisting of a mixture of diastereomers. It is used in pharmaceutical research and development, particularly for its potential sympathomimetic properties. This compound is studied for its effects on the central nervous system and potential therapeutic applications in treating conditions like nasal congestion and hypotension. Its diastereomeric nature allows for diverse pharmacological investigations.
Catalog Number | R048246 |
CAS Number | 63991-20-8 |
Synonyms | α-[1-[(2-Hydroxyethyl)amino]ethyl]benzenemethanol Hydrochloride; α-[1-[(2-Hydroxyethyl)amino]ethyl]benzyl Alcohol Hydrochloride; NSC 95432; |
Molecular Formula | C11H18ClNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(2-hydroxyethylamino)-1-phenylpropan-1-ol;hydrochloride |
InChI | InChI=1S/C11H17NO2.ClH/c1-9(12-7-8-13)11(14)10-5-3-2-4-6-10;/h2-6,9,11-14H,7-8H2,1H3;1H |
InChIKey | YGIPNGHJLVOBQO-UHFFFAOYSA-N |
SMILES | CC(C(C1=CC=CC=C1)O)NCCO.Cl |