For research use only. Not for therapeutic Use.
N-(2-hydroxypropyl)ethylenediamine(Cat No.:M066957), is a chemical compound that falls into the category of organic amines. It is a clear, colorless liquid with a chemical structure that includes both amino (-NH2) and hydroxyl (-OH) functional groups, making it a versatile compound in various chemical reactions. N-(2-hydroxypropyl)ethylenediamine is commonly used as a building block or intermediate in the synthesis of chemicals, including pharmaceuticals, agrochemicals, and specialty chemicals.
CAS Number | 123-84-2 |
Molecular Formula | C5H14N2O |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | 1-(2-aminoethylamino)propan-2-ol |
InChI | InChI=1S/C5H14N2O/c1-5(8)4-7-3-2-6/h5,7-8H,2-4,6H2,1H3 |
InChIKey | CWKVFRNCODQPDB-UHFFFAOYSA-N |
SMILES | CC(CNCCN)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |