For research use only. Not for therapeutic Use.
N-(2-Mercaptoethyl)acetamide(Cat No.:M048860) is an organic compound characterized by a thiol group (-SH) attached to an ethyl chain, which is further linked to an acetamide group. This structure imparts unique chemical properties, such as the ability to form disulfide bonds and chelate metal ions, making it valuable in various chemical and biochemical applications. It is commonly used as a stabilizing agent in protein formulations, as it helps to prevent oxidation of thiol groups in proteins. Additionally, its metal-chelating properties make it useful in detoxification processes and as a ligand in coordination chemistry for synthesizing complex metal compounds.
CAS Number | 1190-73-4 |
Molecular Formula | C4H9NOS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-(2-sulfanylethyl)acetamide |
InChI | InChI=1S/C4H9NOS/c1-4(6)5-2-3-7/h7H,2-3H2,1H3,(H,5,6) |
InChIKey | AXFZADXWLMXITO-UHFFFAOYSA-N |
SMILES | CC(=O)NCCS |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |