For research use only. Not for therapeutic Use.
N-(2,4-Dichloropyrimidin-5-yl)acetamide(Cat No.:L007204), is a chemical compound. It features a pyrimidine ring—a six-membered heterocyclic structure—substituted with a dichloro pyrimidine-5-yl group at the N position and an acetamide group at the 1st position. This compound is valuable in organic synthesis and medicinal chemistry research. Its unique structure makes it versatile for designing diverse organic molecules, contributing to the development of specialized compounds for various applications, including pharmaceuticals and agrochemicals. Researchers utilize it as a key intermediate, aiding in the synthesis of complex organic molecules and contributing to advancements in chemical research and drug discovery.
CAS Number | 89581-88-4 |
Molecular Formula | C6H5Cl2N3O |
Purity | ≥95% |
IUPAC Name | N-(2,4-dichloropyrimidin-5-yl)acetamide |
InChI | InChI=1S/C6H5Cl2N3O/c1-3(12)10-4-2-9-6(8)11-5(4)7/h2H,1H3,(H,10,12) |
InChIKey | VHZSVPKEMDVFGI-UHFFFAOYSA-N |
SMILES | CC(=O)NC1=CN=C(N=C1Cl)Cl |