For research use only. Not for therapeutic Use.
N’-(2,4-Dimethylphenyl)-N-dimethylformamide hydrochloride(Cat No.:R045936), is a chemical compound frequently used as an intermediate in organic synthesis and pharmaceutical research. Its chemical structure features a formamide group (–CONH2) and a methyl group attached to a 2,4-dimethylphenyl ring. This compound’s versatility makes it valuable in creating complex organic molecules, particularly in drug discovery and development.
CAS Number | 51550-40-4 |
Synonyms | N-(2,4-Dimethylphenyl)-N’-methylmethanimidamide Hydrochloride; N-(2,4-Dimethylphenyl)-N’-methyl methylamidine Hydrochloride; Danjiami; N-(2,4-Dimethylphenyl)-N’-methylmethanimidamide Hydrochloride; N-Methyl-N’-(2,4-xylyl)formamidine Hydrochloride; N’ |
Molecular Formula | C10H15ClN2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | N-(2,4-dimethylphenyl)-N/'-methylmethanimidamide;hydrochloride |
InChI | InChI=1S/C10H14N2.ClH/c1-8-4-5-10(9(2)6-8)12-7-11-3;/h4-7H,1-3H3,(H,11,12);1H |
InChIKey | VXSNJXDZTGFDMB-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)NC=NC)C.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |