For research use only. Not for therapeutic Use.
N-((2R,3R,4S,5R)-3,4,5,6-Tetrahydroxy-1-oxohexan-2-yl)pent-4-ynamide(Cat No.:L007508), is a complex chemical compound with a specific stereochemical arrangement. Its molecular structure consists of a pentynamide chain linked to a hexanoyl group bearing a tetrahydroxy substituent. This compound is of particular interest in biochemical research and drug development due to its unique structure and potential biological activities.
CAS Number | 1030262-99-7 |
Molecular Formula | C11H17NO6 |
Purity | ≥95% |
IUPAC Name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]pent-4-ynamide |
InChI | InChI=1S/C11H17NO6/c1-2-3-4-9(16)12-7(5-13)10(17)11(18)8(15)6-14/h1,5,7-8,10-11,14-15,17-18H,3-4,6H2,(H,12,16)/t7-,8+,10+,11+/m0/s1 |
InChIKey | XPUPYWMDKTXDBF-SCVMZPAESA-N |
SMILES | C#CCCC(=O)NC(C=O)C(C(C(CO)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |