For research use only. Not for therapeutic Use.
N-(3-Aminopropyl)-n-dodecylpropane-1,3-diamine(Cat No.:R034171) is a specialized chemical compound featuring a long alkyl chain and multiple amine groups. It is primarily used as a surfactant due to its ability to reduce surface tension between different media, making it valuable in formulations of cleaning agents, detergents, and emulsifiers. The structure facilitates the compound’s interaction with both organic and aqueous substances, enhancing solubility and stability. In industrial applications, it serves as a corrosion inhibitor and is used in the manufacture of personal care products, showcasing its versatility in various chemical and industrial processes.
CAS Number | 2372-82-9 |
Synonyms | Grotan BA 21; Lonzabac 12; Lonzabac 12.100; Lonzabac 12.30; Lonzabac 1230;?Mistral; N,N-Bis(3-aminopropyl)dodecylamine; N,N-Bis(3-aminopropyl)laurylamine;?RC 5637; Triameen Y 12; Triameen Y 12D; Triamine Y 12D; |
Molecular Formula | C18H41N3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N'-(3-aminopropyl)-N'-dodecylpropane-1,3-diamine |
InChI | InChI=1S/C18H41N3/c1-2-3-4-5-6-7-8-9-10-11-16-21(17-12-14-19)18-13-15-20/h2-20H2,1H3 |
InChIKey | NYNKJVPRTLBJNQ-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCN(CCCN)CCCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |