For research use only. Not for therapeutic Use.
N-(3,6-dichloropyridazin-4-yl)acetamide(CAT: L000283) is a compound of significance in pharmaceutical chemistry. This chemical serves as a crucial intermediate in the synthesis of pharmaceutical compounds. Its action method involves acting as a key building block in the development of drug candidates, especially in the context of drug discovery and development.
Catalog Number | L000283 |
CAS Number | 121163-50-6 |
Molecular Formula | C6H5Cl2N3O |
Purity | ≥95% |
IUPAC Name | N-(3,6-dichloropyridazin-4-yl)acetamide |
InChI | InChI=1S/C6H5Cl2N3O/c1-3(12)9-4-2-5(7)10-11-6(4)8/h2H,1H3,(H,9,10,12) |
InChIKey | MXSSLZQKPIFINM-UHFFFAOYSA-N |