For research use only. Not for therapeutic Use.
N-[(3s)-2-Oxotetrahydrofuran-3-yl]decanamide(Cat No.:R074803)is a specialized organic compound used in pharmaceutical and chemical research. This compound features a tetrahydrofuran ring with an oxo group at the 3-position, attached to a decanamide chain. It plays a role in the development of novel drug molecules, particularly in designing compounds with specific bioactive properties. Due to its unique structure, N-[(3s)-2-Oxotetrahydrofuran-3-yl]decanamide is valuable for studies focused on metabolic pathways and synthesis of chiral molecules, offering potential for further applications in therapeutic research and molecular biology.
CAS Number | 177315-87-6 |
Molecular Formula | C14H25NO3 |
Purity | ≥95% |
Target | NF-κB |
IUPAC Name | N-[(3S)-2-oxooxolan-3-yl]decanamide |
InChI | InChI=1S/C14H25NO3/c1-2-3-4-5-6-7-8-9-13(16)15-12-10-11-18-14(12)17/h12H,2-11H2,1H3,(H,15,16)/t12-/m0/s1 |
InChIKey | TZWZKDULKILUPV-LBPRGKRZSA-N |
SMILES | CCCCCCCCCC(=O)N[C@H]1CCOC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |