Home
>
Chemical Reagents>Heterocyclic Building Blocks> N-(4-(2-(benzyl(methyl)amino)ethyl)phenyl)-5-(pyridin-3-yl)thiazol-2-amine hydrobromide
For research use only. Not for therapeutic Use.
N-(4-(2-(benzyl(methyl)amino)ethyl)phenyl)-5-(pyridin-3-yl)thiazol-2-amine hydrobromide (Cat.No:L004001) is a crucial compound in medicinal chemistry. Its intricate structure, incorporating a thiazole, pyridine, and benzylmethylamino group, showcases potential for drug development. This compound serves as a key scaffold in the synthesis of bioactive molecules, particularly in the field of pharmaceuticals.
CAS Number | 1263068-83-2 |
Molecular Formula | C24H25BrN4S |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | N-[4-[2-[benzyl(methyl)amino]ethyl]phenyl]-5-pyridin-3-yl-1,3-thiazol-2-amine;hydrobromide |
InChI | InChI=1S/C24H24N4S.BrH/c1-28(18-20-6-3-2-4-7-20)15-13-19-9-11-22(12-10-19)27-24-26-17-23(29-24)21-8-5-14-25-16-21;/h2-12,14,16-17H,13,15,18H2,1H3,(H,26,27);1H |
InChIKey | LQGOJHGNGSOUKL-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |