Home
>
Inhibitors/Agonists>GPCR/G Protein>LPL Receptor> N-(4-(aminomethyl)-2,6-dimethylphenyl)-5-(2,5-dichlorophenyl)furan-2-carboxamide
For research use only. Not for therapeutic Use.
N-(4-(Aminomethyl)-2,6-dimethylphenyl)-5-(2,5-dichlorophenyl)furan-2-carboxamide(Cat No.:L004783) is a chemically intricate compound with potential pharmacological significance. Its structure, encompassing a furan ring, an aminomethyl group, and a carboxamide moiety, suggests multifaceted interactions. This compound might engage with specific receptors or enzymes, making it intriguing for medicinal chemistry and drug development. Its mode of action could involve modulating cellular processes, potentially impacting disease-related pathways. Its distinct chemical attributes enable the construction of complex molecular architectures, contributing to the design of novel compounds for pharmaceuticals and materials science. Its utility extends to synthetic strategies aiming to create molecules with tailored properties for diverse scientific applications.
CAS Number | 1314212-39-9 |
Molecular Formula | C20H18Cl2N2O2 |
Purity | ≥95% |
Target | LPL Receptor |
IUPAC Name | N-[4-(aminomethyl)-2,6-dimethylphenyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide |
InChI | InChI=1S/C20H18Cl2N2O2/c1-11-7-13(10-23)8-12(2)19(11)24-20(25)18-6-5-17(26-18)15-9-14(21)3-4-16(15)22/h3-9H,10,23H2,1-2H3,(H,24,25) |
InChIKey | QWJOPXDAQCDRRM-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1NC(=O)C2=CC=C(O2)C3=C(C=CC(=C3)Cl)Cl)C)CN |