For research use only. Not for therapeutic Use.
N-(4-Anilinophenyl)benzamide(Cat No.:M247025) is a chemical compound. It consists of a benzamide group attached to a phenyl ring substituted with an aniline group at the para position. This compound has been studied for its potential biological activities, including its role as a pharmacophore in drug design. Compounds similar to N-(4-Anilinophenyl)benzamide have shown promise in various therapeutic areas, such as cancer treatment and antiviral activity. The presence of the aniline and benzamide groups in its structure suggests potential interactions with biological targets, making it a subject of interest in medicinal chemistry research.
CAS Number | 5249-49-0 |
Molecular Formula | C19H16N2O |
Purity | ≥95% |
IUPAC Name | N-(4-anilinophenyl)benzamide |
InChI | InChI=1S/C19H16N2O/c22-19(15-7-3-1-4-8-15)21-18-13-11-17(12-14-18)20-16-9-5-2-6-10-16/h1-14,20H,(H,21,22) |
InChIKey | GIXMMHJWAHQSSW-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)NC3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |