For research use only. Not for therapeutic Use.
N-(4-Fluorophenyl)-1,3-benzothiazol-2-amine(Cat No.:L007076), is an organic compound with a benzothiazole core and a 4-fluorophenyl substituent. It is employed in medicinal chemistry as a valuable intermediate and scaffold in the synthesis of biologically active molecules. Compounds with similar structures have demonstrated diverse pharmacological activities, including anticancer and antimicrobial properties. Researchers utilize N-(4-fluorophenyl)-1,3-benzothiazol-2-amine as a starting material to design and synthesize novel drugs, making it significant in drug discovery and development. Its role as a chemical intermediate contributes to the creation of compounds for pharmaceutical research, aiding in the advancement of treatments for various diseases.
CAS Number | 348-45-8 |
Molecular Formula | C13H9FN2S |
Purity | ≥95% |
IUPAC Name | N-(4-fluorophenyl)-1,3-benzothiazol-2-amine |
InChI | InChI=1S/C13H9FN2S/c14-9-5-7-10(8-6-9)15-13-16-11-3-1-2-4-12(11)17-13/h1-8H,(H,15,16) |
InChIKey | KQKQLYWDIYNFJP-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)N=C(S2)NC3=CC=C(C=C3)F |