For research use only. Not for therapeutic Use.
N-(4-Formyl-3-(trifluoromethyl)phenyl)acetamide (Cat.No:L003747) holds vital importance in pharmaceutical research. Its structure, featuring a trifluoromethyl-substituted phenyl ring, bestows unique reactivity and pharmacological properties. This compound serves as a crucial intermediate in the synthesis of specialized pharmaceutical agents with potential therapeutic applications.
Catalog Number | L003747 |
CAS Number | 2442597-68-2 |
Molecular Formula | C10H8F3NO2 |
Purity | ≥95% |
IUPAC Name | N-[4-formyl-3-(trifluoromethyl)phenyl]acetamide |
InChI | InChI=1S/C10H8F3NO2/c1-6(16)14-8-3-2-7(5-15)9(4-8)10(11,12)13/h2-5H,1H3,(H,14,16) |
InChIKey | LHJOOTINFHVOGP-UHFFFAOYSA-N |
SMILES | CC(=O)NC1=CC(=C(C=C1)C=O)C(F)(F)F |