Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
N-(4-hydroxyphenyl)-2-(1H-pyrazol-1-yl)acetamide
For research use only. Not for therapeutic Use.
N-(4-hydroxyphenyl)-2-(1H-pyrazol-1-yl)acetamide(Cat No.:L007611), is a chemical compound characterized by an acetamide group attached to a phenyl ring with a hydroxy group at the 4-position and a pyrazol-1-yl group at the 2-position. This specific molecular structure is significant in medicinal chemistry and drug discovery. Researchers study its interactions with biological targets, exploring its potential therapeutic applications. Its unique arrangement allows for diverse chemical modifications, enabling the development of compounds for biological testing. Scientists leverage its properties to design and synthesize novel substances, contributing to advancements in pharmaceutical research and the development of potential pharmaceutical agents.
Catalog Number | L007611 |
CAS Number | 1152836-90-2 |
Molecular Formula | C11H11N3O2 |
Purity | ≥95% |
IUPAC Name | N-(4-hydroxyphenyl)-2-pyrazol-1-ylacetamide |
InChI | InChI=1S/C11H11N3O2/c15-10-4-2-9(3-5-10)13-11(16)8-14-7-1-6-12-14/h1-7,15H,8H2,(H,13,16) |
InChIKey | BSUVSWPKCMWXTE-UHFFFAOYSA-N |
SMILES | C1=CN(N=C1)CC(=O)NC2=CC=C(C=C2)O |