For research use only. Not for therapeutic Use.
N(8)-acetylspermidine(Cat No.:M066229) is a derivative of spermidine, a polyamine essential for cellular functions like DNA stabilization and protein synthesis regulation. In N(8)-acetylspermidine, an acetyl group (-COCH3) substitutes one of the amine groups at the nitrogen atom in position 8 of the spermidine molecule. This modification alters its biochemical properties, affecting its interactions with proteins and nucleic acids. N(8)-acetylspermidine is implicated in various physiological processes, including cell proliferation, differentiation, and apoptosis.
CAS Number | 13431-24-8 |
Molecular Formula | C9H21N3O |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | N-[4-(3-aminopropylamino)butyl]acetamide |
InChI | InChI=1S/C9H21N3O/c1-9(13)12-8-3-2-6-11-7-4-5-10/h11H,2-8,10H2,1H3,(H,12,13) |
InChIKey | FONIWJIDLJEJTL-UHFFFAOYSA-N |
SMILES | CC(=O)NCCCCNCCCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |