For research use only. Not for therapeutic Use.
N-Acetyl-4-S-cysteaminylphenol(Cat No.:L006981), is a compound used in the field of medicine and biochemistry. It is a derivative of cysteaminylphenol, a chemical compound with potential antioxidant properties. Research suggests that compounds like N-acetyl-4-S-cysteaminylphenol may have neuroprotective effects and could be beneficial in the treatment of neurodegenerative disorders. Understanding its properties and potential applications is crucial in the development of novel therapeutic agents for various diseases, especially those involving oxidative stress.
Catalog Number | L006981 |
CAS Number | 91281-32-2 |
Molecular Formula | C10H13NO2S |
Purity | ≥95% |
IUPAC Name | N-[2-(4-hydroxyphenyl)sulfanylethyl]acetamide |
InChI | InChI=1S/C10H13NO2S/c1-8(12)11-6-7-14-10-4-2-9(13)3-5-10/h2-5,13H,6-7H2,1H3,(H,11,12) |
InChIKey | FDPFDQAWKAWHMY-UHFFFAOYSA-N |
SMILES | CC(=O)NCCSC1=CC=C(C=C1)O |