For research use only. Not for therapeutic Use.
N-Acetyl-L-cysteine (NAC) is a derivative of the amino acid L-cysteine. It is renowned for its antioxidant properties and ability to replenish glutathione levels, crucial for cellular protection against oxidative stress. NAC is widely used in medicine to treat acetaminophen overdose, respiratory conditions like bronchitis, and psychiatric disorders. Additionally, its antioxidant and anti-inflammatory effects make it a promising adjunct therapy for various health conditions.
CAS Number | 25779-79-7 |
Synonyms | N-Acetylcysteine-cysteine Disulfide; N-Acetylcystine; N-Monoacetylcystine |
Molecular Formula | C8H14N2O5S2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R)-3-[[(2R)-2-acetamido-2-carboxyethyl]disulfanyl]-2-aminopropanoic acid |
InChI | InChI=1S/C8H14N2O5S2/c1-4(11)10-6(8(14)15)3-17-16-2-5(9)7(12)13/h5-6H,2-3,9H2,1H3,(H,10,11)(H,12,13)(H,14,15)/t5-,6-/m0/s1 |
InChIKey | ZLCOWUKVVFVVKA-WDSKDSINSA-N |
SMILES | CC(=O)NC(CSSCC(C(=O)O)N)C(=O)O |