Home
>
Isotope Labeled Compounds>Isotope Labeled Amino Acids & Peptides> N-Acetyl-L-glutamic acid-d5
For research use only. Not for therapeutic Use.
N-acetyl-l-glutamic acid-d5(Cat No.:S000584) is a specialized form of N-acetyl-L-glutamic acid, a derivative of glutamic acid involved in amino acid metabolism and neurotransmission regulation. The “d5” designation indicates that five hydrogen atoms in the molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic substitution enables precise tracking of N-acetyl-L-glutamic acid metabolism and its incorporation into various biochemical pathways using techniques like mass spectrometry. N-Acetyl-L-glutamic acid-d5 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating disorders related to glutamic acid metabolism, such as urea cycle disorders.
Catalog Number | S000584 |
Molecular Formula | C7H6D5NO5 |
Purity | ≥95% |
IUPAC Name | 2-acetamido-2,3,3,4,4-pentadeuteriopentanedioic acid |
InChI | InChI=1S/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13)/i2D2,3D2,5D |
InChIKey | RFMMMVDNIPUKGG-WHVBSWTDSA-N |
SMILES | CC(=O)NC(CCC(=O)O)C(=O)O |