For research use only. Not for therapeutic Use.
N-Acetyl-L-(-)-leucine(Cat No.:R022043), is a chemical compound derived from the essential amino acid L-leucine. It features an acetyl group (-COCH3) attached to the amino group of L-leucine. This modification can affect the molecule’s chemical properties and biological activity. It is commonly employed in biochemical and pharmaceutical research for its role as a building block in the synthesis of peptides, pharmaceuticals, and other bioactive compounds. Additionally, it is used to investigate the functions and effects of L-leucine and its derivatives in various biological processes.
CAS Number | 1188-21-2 |
Synonyms | (S)-2-Acetamido-4-methylpentanoic Acid; Acetyl-L-leucine; Acetylleucine; N-Acetyl-L-leucine; N-Acetylleucine; NSC 206316 |
Molecular Formula | C8H15NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Room Temperature |
IUPAC Name | (2S)-2-acetamido-4-methylpentanoic acid |
InChI | InChI=1S/C8H15NO3/c1-5(2)4-7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t7-/m0/s1 |
InChIKey | WXNXCEHXYPACJF-ZETCQYMHSA-N |
SMILES | CC(C)CC(C(=O)O)NC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |