For research use only. Not for therapeutic Use.
N-Acetyl-L-serine(CAT: M075786) is a chemical compound that is significant in the field of biochemistry and pharmaceuticals. Its action method involves its role as an acetylated derivative of the amino acid L-serine. This modification can impact the properties and functions of proteins and peptides that contain L-serine residues, making it relevant in the study of protein structure and function. Additionally, N-Acetyl-L-serine can be used as a building block in the synthesis of various pharmaceuticals and bioactive compounds, highlighting its importance in drug development and medicinal chemistry.
CAS Number | 16354-58-8 |
Molecular Formula | C5H9NO4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (2S)-2-acetamido-3-hydroxypropanoic acid |
InChI | InChI=1S/C5H9NO4/c1-3(8)6-4(2-7)5(9)10/h4,7H,2H2,1H3,(H,6,8)(H,9,10)/t4-/m0/s1 |
InChIKey | JJIHLJJYMXLCOY-BYPYZUCNSA-N |
SMILES | CC(=O)NC(CO)C(=O)O |