For research use only. Not for therapeutic Use.
N-Acetyl-L-tyrosine-d3(Cat No.:S000626) is a deuterium-labeled version of the amino acid derivative N-acetyl-L-tyrosine, where three hydrogen atoms are replaced with deuterium (D), a non-radioactive isotope of hydrogen. This labeling enhances the stability and detection of the compound in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy studies. Researchers use it to explore the metabolic pathways of tyrosine and its derivatives, particularly focusing on how acetylation affects its biological activity and metabolism. The use of N-Acetyl-L-tyrosine-d3 provides valuable insights into neurotransmitter synthesis and protein interaction studies in neurochemical and physiological research.
Molecular Formula | C11H10D3NO4 |
Purity | ≥95% |
IUPAC Name | (2S)-3-(4-hydroxyphenyl)-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
InChI | InChI=1S/C11H13NO4/c1-7(13)12-10(11(15)16)6-8-2-4-9(14)5-3-8/h2-5,10,14H,6H2,1H3,(H,12,13)(H,15,16)/t10-/m0/s1/i1D3 |
InChIKey | CAHKINHBCWCHCF-ASGODXDTSA-N |
SMILES | CC(=O)NC(CC1=CC=C(C=C1)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |